Naming Alkanes Practice- Worksheets and Examples for Mastery

Why Naming Alkanes Feels Harder Than It Should

Most students approach IUPAC nomenclature expecting some hidden trick. There isn't one. Naming alkanes is a skill, and like any skill, you get better by doing it wrong first. A lot.

Your textbook probably threw 40 rules at you before showing a single example. That's backwards. You need to see how it works, then practice until the process becomes automatic.

This guide gives you the rules you actually need, worked examples, and practice problems with answers. No motivational filler.

The Basic IUPAC Rules for Naming Alkanes

Alkanes are saturated hydrocarbons with single bonds only. The naming system follows a pattern you can learn in an afternoon if you stop trying to memorize everything at once.

Step 1: Find the Longest Chain

Count the carbon atoms in the longest continuous chain. This determines the parent name.

Beyond decane, you just use the Greek number prefix (un-, do-, tri-, etc.) but you won't see those often in introductory problems.

Step 2: Number the Chain

Start from the end that gives the substituents the lowest numbers. This is the lowest set rule. If there's a tie, look at the next set of numbers.

Example: A chain with methyl groups at positions 2 and 5 beats one with methyls at 3 and 4. The first set (2,5) has a lower number than (3,4).

Step 3: Name the Substituents

Alkyl groups are what branch off the main chain. Common ones:

Use numbers to show where each substituent attaches to the parent chain.

Step 4: Assemble the Name

Format: Position – Substituent – Parent

If there are multiple identical substituents, use prefixes:

Alphabetical order matters for substituents, but prefixes (di, tri, etc.) don't count.

Worked Examples: Naming Alkanes

Example 1: Simple Branched Alkane

Structure: A 5-carbon chain (pentane) with a methyl group on carbon 2.

Name: 2-methylpentane

Why? The longest chain is 5 carbons (pentane). Numbering from the left gives the methyl position 2. Numbering from the right would give position 4, which is higher.

Example 2: Multiple Substituents

Structure: A 7-carbon chain (heptane) with methyl groups on carbons 2 and 4.

Name: 2,4-dimethylheptane

Why? Both numbering directions give the same set (2,4), so either direction works. The "di-" prefix shows there are two methyl groups.

Example 3: Finding the Longest Chain

This trips people up. Look at a structure with 8 carbons total, but not all in a straight line.

You need to find the longest continuous path, not just count carbons. Sometimes a chain that looks shorter actually has a longer hidden path when you trace it correctly.

Name: 3-methylhexane

Why? Some students count 7 carbons and call it heptane with an ethyl branch. Wrong. The longest chain is actually 6 carbons, making it a hexane with a methyl substituent.

Common Mistakes That Cost You Points

Practice Problems with Answers

Try these before checking the answers. That's where the learning happens.

Problem 1

Name: CH3-CH(CH3)-CH2-CH2-CH3

Answer: 2-methylpentane

Problem 2

Name: CH3-CH2-CH(CH3)-CH(CH3)-CH2-CH3

Answer: 3,4-dimethylhexane

Problem 3

Name: (CH3)3C-CH2-CH(CH3)-CH3

Answer: 2,2,4-trimethylpentane

Yes, that's a branched structure. The "tert-butyl" group (the (CH3)3C-) counts as a substituent on the main chain.

How to Actually Get Better

Reading about naming alkanes doesn't make you better at naming alkanes. Drawing structures does.

Here's a drill that works:

  1. Look at a name
  2. Draw it without looking at the answer
  3. Name your drawing back
  4. Compare to the original

If step 3 doesn't match step 1, you found a gap in your understanding. That's the point.

Quick Reference Table

Carbon Count Parent Name Formula
1 Methane CH4
2 Ethane C2H6
3 Propane C3H8
4 Butane C4H10
5 Pentane C5H12
6 Hexane C6H14
7 Heptane C7H16
8 Octane C8H18
9 Nonane C9H20
10 Decane C10H22

When to Use Worksheets vs. Just Practicing

Worksheets help when you need structure. If you're just starting out, use them. If you're past the basics and making specific mistakes, targeted practice beats generic worksheets every time.

For worksheets, look for ones that include:

Skip worksheets that only ask "name this compound" in one direction. You need both directions to build real fluency.

The Bottom Line

Naming alkanes isn't complicated. It's systematic. Learn the steps, practice both directions, and check your work. That's it.

Stop reading. Start drawing.